C13H21Cl2N3O — CID 138393542
N,N-dimethyl-3-piperazin-1-ylbenzamide;dihydrochloride (PubChem CID 138393542) has the molecular formula C13H21Cl2N3O and a molecular weight of 306.24 g/mol. Its IUPAC name is N,N-dimethyl-3-piperazin-1-ylbenzamide;dihydrochloride.
| Compound Name | N,N-dimethyl-3-piperazin-1-ylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 138393542 |
| Molecular Formula | C13H21Cl2N3O |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N,N-dimethyl-3-piperazin-1-ylbenzamide;dihydrochloride |
| SMILES | CN(C)C(=O)c1cccc(N2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C13H19N3O.2ClH/c1-15(2)13(17)11-4-3-5-12(10-11)16-8-6-14-7-9-16;;/h3-5,10,14H,6-9H2,1-2H3;2*1H |
| InChIKey | GECZMJCEBBGJBR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |