C14H22ClN3O3S — CID 119969871
N,N-dimethyl-3-(2-methylpiperazin-1-yl)sulfonylbenzamide;hydrochloride (PubChem CID 119969871) has the molecular formula C14H22ClN3O3S and a molecular weight of 347.87 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-methylpiperazin-1-yl)sulfonylbenzamide;hydrochloride.
| Compound Name | N,N-dimethyl-3-(2-methylpiperazin-1-yl)sulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119969871 |
| Molecular Formula | C14H22ClN3O3S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N,N-dimethyl-3-(2-methylpiperazin-1-yl)sulfonylbenzamide;hydrochloride |
| SMILES | CC1CNCCN1S(=O)(=O)c1cccc(C(=O)N(C)C)c1.Cl |
| InChI | InChI=1S/C14H21N3O3S.ClH/c1-11-10-15-7-8-17(11)21(19,20)13-6-4-5-12(9-13)14(18)16(2)3;/h4-6,9,11,15H,7-8,10H2,1-3H3;1H |
| InChIKey | QIXMBKQCQZIWMV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |