C12H19ClN2O4S2 — CID 120716978
(2R)-2-methyl-1-(4-methylsulfonylphenyl)sulfonylpiperazine;hydrochloride (PubChem CID 120716978) has the molecular formula C12H19ClN2O4S2 and a molecular weight of 354.88 g/mol. Its IUPAC name is (2R)-2-methyl-1-(4-methylsulfonylphenyl)sulfonylpiperazine;hydrochloride.
| Compound Name | (2R)-2-methyl-1-(4-methylsulfonylphenyl)sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120716978 |
| Molecular Formula | C12H19ClN2O4S2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (2R)-2-methyl-1-(4-methylsulfonylphenyl)sulfonylpiperazine;hydrochloride |
| SMILES | C[C@@H]1CNCCN1S(=O)(=O)c1ccc(S(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C12H18N2O4S2.ClH/c1-10-9-13-7-8-14(10)20(17,18)12-5-3-11(4-6-12)19(2,15)16;/h3-6,10,13H,7-9H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | KEECTIUMIGMXGO-HNCPQSOCSA-N |
| XLogP | 0.49 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |