C15H25ClN2O2S — CID 120717091
(2S)-2-methyl-1-[4-(2-methylpropyl)phenyl]sulfonylpiperazine;hydrochloride (PubChem CID 120717091) has the molecular formula C15H25ClN2O2S and a molecular weight of 332.90 g/mol. Its IUPAC name is (2S)-2-methyl-1-[4-(2-methylpropyl)phenyl]sulfonylpiperazine;hydrochloride.
| Compound Name | (2S)-2-methyl-1-[4-(2-methylpropyl)phenyl]sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120717091 |
| Molecular Formula | C15H25ClN2O2S |
| Molecular Weight | 332.90 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (2S)-2-methyl-1-[4-(2-methylpropyl)phenyl]sulfonylpiperazine;hydrochloride |
| SMILES | CC(C)Cc1ccc(S(=O)(=O)N2CCNC[C@@H]2C)cc1.Cl |
| InChI | InChI=1S/C15H24N2O2S.ClH/c1-12(2)10-14-4-6-15(7-5-14)20(18,19)17-9-8-16-11-13(17)3;/h4-7,12-13,16H,8-11H2,1-3H3;1H/t13-;/m0./s1 |
| InChIKey | JKLOBJXPROTNDP-ZOWNYOTGSA-N |
| XLogP | 2.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.90 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |