C13H19N3OS — CID 168532031
[(2-pentylsulfanylphenyl)methylideneamino]urea (PubChem CID 168532031) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is [(2-pentylsulfanylphenyl)methylideneamino]urea.
| Compound Name | [(2-pentylsulfanylphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 168532031 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | [(2-pentylsulfanylphenyl)methylideneamino]urea |
| SMILES | CCCCCSc1ccccc1C=NNC(N)=O |
| InChI | InChI=1S/C13H19N3OS/c1-2-3-6-9-18-12-8-5-4-7-11(12)10-15-16-13(14)17/h4-5,7-8,10H,2-3,6,9H2,1H3,(H3,14,16,17) |
| InChIKey | ZYVRZLAPPINTBI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|