C12H16N2O2 — CID 135509646
N-[(E)-(2-hydroxyphenyl)methylideneamino]pentanamide (PubChem CID 135509646) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]pentanamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 135509646 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]pentanamide |
| SMILES | CCCCC(=O)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C12H16N2O2/c1-2-3-8-12(16)14-13-9-10-6-4-5-7-11(10)15/h4-7,9,15H,2-3,8H2,1H3,(H,14,16)/b13-9+ |
| InChIKey | VXFLFMLEZVPKDP-UKTHLTGXSA-N |
| XLogP | 2.03 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|