C18H24N2O5 — CID 155719125
4-[3-formyl-2-[methyl(1-oxopentan-2-yl)carbamoyl]anilino]butanoic acid (PubChem CID 155719125) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-[3-formyl-2-[methyl(1-oxopentan-2-yl)carbamoyl]anilino]butanoic acid.
| Compound Name | 4-[3-formyl-2-[methyl(1-oxopentan-2-yl)carbamoyl]anilino]butanoic acid |
|---|---|
| PubChem CID | 155719125 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 4-[3-formyl-2-[methyl(1-oxopentan-2-yl)carbamoyl]anilino]butanoic acid |
| SMILES | CCCC(C=O)N(C)C(=O)c1c(C=O)cccc1NCCCC(=O)O |
| InChI | InChI=1S/C18H24N2O5/c1-3-6-14(12-22)20(2)18(25)17-13(11-21)7-4-8-15(17)19-10-5-9-16(23)24/h4,7-8,11-12,14,19H,3,5-6,9-10H2,1-2H3,(H,23,24) |
| InChIKey | ZBKLDXQWYMLWIJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|