C21H34N4O4 — CID 163266159
2-(7-aminoheptylamino)-6-formyl-N-methyl-N'-(5-oxopentoxy)benzohydrazide (PubChem CID 163266159) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-(7-aminoheptylamino)-6-formyl-N-methyl-N'-(5-oxopentoxy)benzohydrazide.
| Compound Name | 2-(7-aminoheptylamino)-6-formyl-N-methyl-N'-(5-oxopentoxy)benzohydrazide |
|---|---|
| PubChem CID | 163266159 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-(7-aminoheptylamino)-6-formyl-N-methyl-N'-(5-oxopentoxy)benzohydrazide |
| SMILES | CN(NOCCCCC=O)C(=O)c1c(C=O)cccc1NCCCCCCCN |
| InChI | InChI=1S/C21H34N4O4/c1-25(24-29-16-9-5-8-15-26)21(28)20-18(17-27)11-10-12-19(20)23-14-7-4-2-3-6-13-22/h10-12,15,17,23-24H,2-9,13-14,16,22H2,1H3 |
| InChIKey | SRKLYIJFVNZLNE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|