C20H25NO6 — CID 164592353
N-(1,5-dioxopentan-2-yl)-2-formyl-N-methyl-6-(6-oxohexoxy)benzamide (PubChem CID 164592353) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is N-(1,5-dioxopentan-2-yl)-2-formyl-N-methyl-6-(6-oxohexoxy)benzamide.
| Compound Name | N-(1,5-dioxopentan-2-yl)-2-formyl-N-methyl-6-(6-oxohexoxy)benzamide |
|---|---|
| PubChem CID | 164592353 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-(1,5-dioxopentan-2-yl)-2-formyl-N-methyl-6-(6-oxohexoxy)benzamide |
| SMILES | CN(C(=O)c1c(C=O)cccc1OCCCCCC=O)C(C=O)CCC=O |
| InChI | InChI=1S/C20H25NO6/c1-21(17(15-25)9-7-12-23)20(26)19-16(14-24)8-6-10-18(19)27-13-5-3-2-4-11-22/h6,8,10-12,14-15,17H,2-5,7,9,13H2,1H3 |
| InChIKey | DZCDDSTWKCOQJV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|