C18H28N4O4 — CID 163266221
2-(2-aminoethylamino)-N-(1,5-dioxopentan-2-yl)-6-formyl-N-methylbenzamide;N-methylmethanamine (PubChem CID 163266221) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-N-(1,5-dioxopentan-2-yl)-6-formyl-N-methylbenzamide;N-methylmethanamine.
| Compound Name | 2-(2-aminoethylamino)-N-(1,5-dioxopentan-2-yl)-6-formyl-N-methylbenzamide;N-methylmethanamine |
|---|---|
| PubChem CID | 163266221 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 2-(2-aminoethylamino)-N-(1,5-dioxopentan-2-yl)-6-formyl-N-methylbenzamide;N-methylmethanamine |
| SMILES | CN(C(=O)c1c(C=O)cccc1NCCN)C(C=O)CCC=O.CNC |
| InChI | InChI=1S/C16H21N3O4.C2H7N/c1-19(13(11-22)5-3-9-20)16(23)15-12(10-21)4-2-6-14(15)18-8-7-17;1-3-2/h2,4,6,9-11,13,18H,3,5,7-8,17H2,1H3;3H,1-2H3 |
| InChIKey | DZMOBWLGFCSYCT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|