C24H34N4O7 — CID 167470955
7-[[2-[3-formyl-2-[methyl-[1-(methylamino)-1,5-dioxopentan-2-yl]carbamoyl]anilino]acetyl]amino]heptanoic acid (PubChem CID 167470955) has the molecular formula C24H34N4O7 and a molecular weight of 490.56 g/mol. Its IUPAC name is 7-[[2-[3-formyl-2-[methyl-[1-(methylamino)-1,5-dioxopentan-2-yl]carbamoyl]anilino]acetyl]amino]heptanoic acid.
| Compound Name | 7-[[2-[3-formyl-2-[methyl-[1-(methylamino)-1,5-dioxopentan-2-yl]carbamoyl]anilino]acetyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 167470955 |
| Molecular Formula | C24H34N4O7 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 7-[[2-[3-formyl-2-[methyl-[1-(methylamino)-1,5-dioxopentan-2-yl]carbamoyl]anilino]acetyl]amino]heptanoic acid |
| SMILES | CNC(=O)C(CCC=O)N(C)C(=O)c1c(C=O)cccc1NCC(=O)NCCCCCCC(=O)O |
| InChI | InChI=1S/C24H34N4O7/c1-25-23(34)19(11-8-14-29)28(2)24(35)22-17(16-30)9-7-10-18(22)27-15-20(31)26-13-6-4-3-5-12-21(32)33/h7,9-10,14,16,19,27H,3-6,8,11-13,15H2,1-2H3,(H,25,34)(H,26,31)(H,32,33) |
| InChIKey | KEEDWKSWTBPWRF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|