C39H52N8O4 — CID 163266017
2-formyl-N-methyl-N-[5-(methylamino)-1,5-dioxopentan-2-yl]-6-[4-[4-[3-(methylideneamino)-4-[2-(2-methylpyrrolidin-1-yl)ethylamino]anilino]anilino]butylamino]benzamide (PubChem CID 163266017) has the molecular formula C39H52N8O4 and a molecular weight of 696.90 g/mol. Its IUPAC name is 2-formyl-N-methyl-N-[5-(methylamino)-1,5-dioxopentan-2-yl]-6-[4-[4-[3-(methylideneamino)-4-[2-(2-methylpyrrolidin-1-yl)ethylamino]anilino]anilino]butylamino]benzamide.
| Compound Name | 2-formyl-N-methyl-N-[5-(methylamino)-1,5-dioxopentan-2-yl]-6-[4-[4-[3-(methylideneamino)-4-[2-(2-methylpyrrolidin-1-yl)ethylamino]anilino]anilino]butylamino]benzamide |
|---|---|
| PubChem CID | 163266017 |
| Molecular Formula | C39H52N8O4 |
| Molecular Weight | 696.90 g/mol |
| Exact Mass | 696.41 |
| IUPAC Name | 2-formyl-N-methyl-N-[5-(methylamino)-1,5-dioxopentan-2-yl]-6-[4-[4-[3-(methylideneamino)-4-[2-(2-methylpyrrolidin-1-yl)ethylamino]anilino]anilino]butylamino]benzamide |
| SMILES | C=Nc1cc(Nc2ccc(NCCCCNc3cccc(C=O)c3C(=O)N(C)C(C=O)CCC(=O)NC)cc2)ccc1NCCN1CCCC1C |
| InChI | InChI=1S/C39H52N8O4/c1-28-9-8-23-47(28)24-22-44-34-18-16-32(25-36(34)40-2)45-31-14-12-30(13-15-31)42-20-5-6-21-43-35-11-7-10-29(26-48)38(35)39(51)46(4)33(27-49)17-19-37(50)41-3/h7,10-16,18,25-28,33,42-45H,2,5-6,8-9,17,19-24H2,1,3-4H3,(H,41,50) |
| InChIKey | JGOVIGRVFYCRPM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 147.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.90 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|