C14H20N2O2S — CID 70597719
3-hexylsulfanylbenzene-1,2-dicarboxamide (PubChem CID 70597719) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-hexylsulfanylbenzene-1,2-dicarboxamide.
| Compound Name | 3-hexylsulfanylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 70597719 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-hexylsulfanylbenzene-1,2-dicarboxamide |
| SMILES | CCCCCCSc1cccc(C(N)=O)c1C(N)=O |
| InChI | InChI=1S/C14H20N2O2S/c1-2-3-4-5-9-19-11-8-6-7-10(13(15)17)12(11)14(16)18/h6-8H,2-5,9H2,1H3,(H2,15,17)(H2,16,18) |
| InChIKey | FXUVRKJVNZHEID-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|