C17H22N2O4 — CID 156711593
ethane;N-formyl-2-(4-methyl-1,3-dioxoisoindol-2-yl)pentanamide (PubChem CID 156711593) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is ethane;N-formyl-2-(4-methyl-1,3-dioxoisoindol-2-yl)pentanamide.
| Compound Name | ethane;N-formyl-2-(4-methyl-1,3-dioxoisoindol-2-yl)pentanamide |
|---|---|
| PubChem CID | 156711593 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | ethane;N-formyl-2-(4-methyl-1,3-dioxoisoindol-2-yl)pentanamide |
| SMILES | CC.CCCC(C(=O)NC=O)N1C(=O)c2cccc(C)c2C1=O |
| InChI | InChI=1S/C15H16N2O4.C2H6/c1-3-5-11(13(19)16-8-18)17-14(20)10-7-4-6-9(2)12(10)15(17)21;1-2/h4,6-8,11H,3,5H2,1-2H3,(H,16,18,19);1-2H3 |
| InChIKey | OHUNSZMCWOSRPY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|