C15H16F2N2O4 — CID 169257425
4,5-difluoro-2-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide (PubChem CID 169257425) has the molecular formula C15H16F2N2O4 and a molecular weight of 326.30 g/mol. Its IUPAC name is 4,5-difluoro-2-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide.
| Compound Name | 4,5-difluoro-2-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 169257425 |
| Molecular Formula | C15H16F2N2O4 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4,5-difluoro-2-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide |
| SMILES | CNC(=O)C(CCC=O)N(C)C(=O)c1cc(F)c(F)cc1C=O |
| InChI | InChI=1S/C15H16F2N2O4/c1-18-14(22)13(4-3-5-20)19(2)15(23)10-7-12(17)11(16)6-9(10)8-21/h5-8,13H,3-4H2,1-2H3,(H,18,22) |
| InChIKey | GCZHPZNSVBLUJH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|