C18H23N5O3 — CID 174243580
N-methyl-5-oxo-2-(1-oxo-6-piperazin-1-ylphthalazin-2-yl)pentanamide (PubChem CID 174243580) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-methyl-5-oxo-2-(1-oxo-6-piperazin-1-ylphthalazin-2-yl)pentanamide.
| Compound Name | N-methyl-5-oxo-2-(1-oxo-6-piperazin-1-ylphthalazin-2-yl)pentanamide |
|---|---|
| PubChem CID | 174243580 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-methyl-5-oxo-2-(1-oxo-6-piperazin-1-ylphthalazin-2-yl)pentanamide |
| SMILES | CNC(=O)C(CCC=O)n1ncc2cc(N3CCNCC3)ccc2c1=O |
| InChI | InChI=1S/C18H23N5O3/c1-19-17(25)16(3-2-10-24)23-18(26)15-5-4-14(11-13(15)12-21-23)22-8-6-20-7-9-22/h4-5,10-12,16,20H,2-3,6-9H2,1H3,(H,19,25) |
| InChIKey | UIBJXCMKAROOPA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|