C21H32N4O4 — CID 170727234
ethane;2-(5-methoxy-3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)-N-methyl-5-oxopentanamide (PubChem CID 170727234) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is ethane;2-(5-methoxy-3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)-N-methyl-5-oxopentanamide.
| Compound Name | ethane;2-(5-methoxy-3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 170727234 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | ethane;2-(5-methoxy-3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)-N-methyl-5-oxopentanamide |
| SMILES | CC.CNC(=O)C(CCC=O)N1Cc2cc(N3CCNCC3)c(OC)cc2C1=O |
| InChI | InChI=1S/C19H26N4O4.C2H6/c1-20-18(25)15(4-3-9-24)23-12-13-10-16(22-7-5-21-6-8-22)17(27-2)11-14(13)19(23)26;1-2/h9-11,15,21H,3-8,12H2,1-2H3,(H,20,25);1-2H3 |
| InChIKey | BUMISCQFFVTAGC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|