C18H23N3O2 — CID 164923758
N-methyl-2-(6-methyl-1-oxo-5,7-dihydro-3H-pyrrolo[3,4-f]isoindol-2-yl)hex-5-enamide (PubChem CID 164923758) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-methyl-2-(6-methyl-1-oxo-5,7-dihydro-3H-pyrrolo[3,4-f]isoindol-2-yl)hex-5-enamide.
| Compound Name | N-methyl-2-(6-methyl-1-oxo-5,7-dihydro-3H-pyrrolo[3,4-f]isoindol-2-yl)hex-5-enamide |
|---|---|
| PubChem CID | 164923758 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-methyl-2-(6-methyl-1-oxo-5,7-dihydro-3H-pyrrolo[3,4-f]isoindol-2-yl)hex-5-enamide |
| SMILES | C=CCCC(C(=O)NC)N1Cc2cc3c(cc2C1=O)CN(C)C3 |
| InChI | InChI=1S/C18H23N3O2/c1-4-5-6-16(17(22)19-2)21-11-14-7-12-9-20(3)10-13(12)8-15(14)18(21)23/h4,7-8,16H,1,5-6,9-11H2,2-3H3,(H,19,22) |
| InChIKey | YONYIDSFNLOYTP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|