C19H26N4O4 — CID 156721862
N-methyl-5-oxo-2-[3-oxo-5-[(propylcarbamoylamino)methyl]-1H-isoindol-2-yl]pentanamide (PubChem CID 156721862) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-methyl-5-oxo-2-[3-oxo-5-[(propylcarbamoylamino)methyl]-1H-isoindol-2-yl]pentanamide.
| Compound Name | N-methyl-5-oxo-2-[3-oxo-5-[(propylcarbamoylamino)methyl]-1H-isoindol-2-yl]pentanamide |
|---|---|
| PubChem CID | 156721862 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-methyl-5-oxo-2-[3-oxo-5-[(propylcarbamoylamino)methyl]-1H-isoindol-2-yl]pentanamide |
| SMILES | CCCNC(=O)NCc1ccc2c(c1)C(=O)N(C(CCC=O)C(=O)NC)C2 |
| InChI | InChI=1S/C19H26N4O4/c1-3-8-21-19(27)22-11-13-6-7-14-12-23(18(26)15(14)10-13)16(5-4-9-24)17(25)20-2/h6-7,9-10,16H,3-5,8,11-12H2,1-2H3,(H,20,25)(H2,21,22,27) |
| InChIKey | DSRPKWUXLROYEM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|