C23H26N4O4 — CID 143902215
1-(4,5-dimethyl-2-pyridinyl)-3-[[2-(2,6-dioxohexan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea (PubChem CID 143902215) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-pyridinyl)-3-[[2-(2,6-dioxohexan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea.
| Compound Name | 1-(4,5-dimethyl-2-pyridinyl)-3-[[2-(2,6-dioxohexan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 143902215 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-(4,5-dimethyl-2-pyridinyl)-3-[[2-(2,6-dioxohexan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
| SMILES | CC(=O)C(CCC=O)N1Cc2cc(CNC(=O)Nc3cc(C)c(C)cn3)ccc2C1=O |
| InChI | InChI=1S/C23H26N4O4/c1-14-9-21(24-11-15(14)2)26-23(31)25-12-17-6-7-19-18(10-17)13-27(22(19)30)20(16(3)29)5-4-8-28/h6-11,20H,4-5,12-13H2,1-3H3,(H2,24,25,26,31) |
| InChIKey | KFRHLOZVCZKCNQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|