C21H30N4O4 — CID 143637992
2-[6-[(hexylcarbamoylamino)methyl]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide (PubChem CID 143637992) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[6-[(hexylcarbamoylamino)methyl]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide.
| Compound Name | 2-[6-[(hexylcarbamoylamino)methyl]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 143637992 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2-[6-[(hexylcarbamoylamino)methyl]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide |
| SMILES | CCCCCCNC(=O)NCc1ccc2c(c1)CN(C(CCC=O)C(N)=O)C2=O |
| InChI | InChI=1S/C21H30N4O4/c1-2-3-4-5-10-23-21(29)24-13-15-8-9-17-16(12-15)14-25(20(17)28)18(19(22)27)7-6-11-26/h8-9,11-12,18H,2-7,10,13-14H2,1H3,(H2,22,27)(H2,23,24,29) |
| InChIKey | QSINWGXJSFLPQI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|