C20H30N4O3 — CID 169161654
ethane;N-methyl-5-oxo-2-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide (PubChem CID 169161654) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is ethane;N-methyl-5-oxo-2-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide.
| Compound Name | ethane;N-methyl-5-oxo-2-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide |
|---|---|
| PubChem CID | 169161654 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | ethane;N-methyl-5-oxo-2-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide |
| SMILES | CC.CNC(=O)C(CCC=O)N1Cc2cc(N3CCNCC3)ccc2C1=O |
| InChI | InChI=1S/C18H24N4O3.C2H6/c1-19-17(24)16(3-2-10-23)22-12-13-11-14(4-5-15(13)18(22)25)21-8-6-20-7-9-21;1-2/h4-5,10-11,16,20H,2-3,6-9,12H2,1H3,(H,19,24);1-2H3 |
| InChIKey | VLSRJFYYUZBDME-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|