C32H43N7O3S — CID 178004610
2-[6-[4-[1-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]azetidin-3-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 178004610) has the molecular formula C32H43N7O3S and a molecular weight of 605.81 g/mol. Its IUPAC name is 2-[6-[4-[1-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]azetidin-3-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[6-[4-[1-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]azetidin-3-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 178004610 |
| Molecular Formula | C32H43N7O3S |
| Molecular Weight | 605.81 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | 2-[6-[4-[1-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]azetidin-3-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2cc(N3CCN(C4CN(c5cccc(SN6CCC(N)CC6)c5)C4)CC3)ccc2C1=O |
| InChI | InChI=1S/C32H43N7O3S/c1-34-31(41)30(6-3-17-40)39-20-23-18-26(7-8-29(23)32(39)42)35-13-15-36(16-14-35)27-21-37(22-27)25-4-2-5-28(19-25)43-38-11-9-24(33)10-12-38/h2,4-5,7-8,17-19,24,27,30H,3,6,9-16,20-22,33H2,1H3,(H,34,41) |
| InChIKey | OZZWORFWNWQUIH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.81 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|