C25H35N5O3 — CID 167480600
2-[6-[4-(4-formylpiperazin-1-yl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methylhex-5-enamide (PubChem CID 167480600) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-[6-[4-(4-formylpiperazin-1-yl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methylhex-5-enamide.
| Compound Name | 2-[6-[4-(4-formylpiperazin-1-yl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 167480600 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 2-[6-[4-(4-formylpiperazin-1-yl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methylhex-5-enamide |
| SMILES | C=CCCC(C(=O)NC)N1Cc2cc(N3CCC(N4CCN(C=O)CC4)CC3)ccc2C1=O |
| InChI | InChI=1S/C25H35N5O3/c1-3-4-5-23(24(32)26-2)30-17-19-16-21(6-7-22(19)25(30)33)28-10-8-20(9-11-28)29-14-12-27(18-31)13-15-29/h3,6-7,16,18,20,23H,1,4-5,8-15,17H2,2H3,(H,26,32) |
| InChIKey | MQONMKHRGAETNE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|