C27H40N4O4 — CID 178161675
2-[6-[4-(2-azaspiro[3.3]heptan-6-yloxy)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide;ethane (PubChem CID 178161675) has the molecular formula C27H40N4O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-[6-[4-(2-azaspiro[3.3]heptan-6-yloxy)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide;ethane.
| Compound Name | 2-[6-[4-(2-azaspiro[3.3]heptan-6-yloxy)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide;ethane |
|---|---|
| PubChem CID | 178161675 |
| Molecular Formula | C27H40N4O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 2-[6-[4-(2-azaspiro[3.3]heptan-6-yloxy)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide;ethane |
| SMILES | CC.CNC(=O)C(CCC=O)N1Cc2cc(N3CCC(OC4CC5(CNC5)C4)CC3)ccc2C1=O |
| InChI | InChI=1S/C25H34N4O4.C2H6/c1-26-23(31)22(3-2-10-30)29-14-17-11-18(4-5-21(17)24(29)32)28-8-6-19(7-9-28)33-20-12-25(13-20)15-27-16-25;1-2/h4-5,10-11,19-20,22,27H,2-3,6-9,12-16H2,1H3,(H,26,31);1-2H3 |
| InChIKey | LZOKFKKHOCDMST-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|