C26H35N5O2S — CID 170639218
benzyl 3-[4-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]piperazin-1-yl]azetidine-1-carboxylate (PubChem CID 170639218) has the molecular formula C26H35N5O2S and a molecular weight of 481.67 g/mol. Its IUPAC name is benzyl 3-[4-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]piperazin-1-yl]azetidine-1-carboxylate.
| Compound Name | benzyl 3-[4-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]piperazin-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 170639218 |
| Molecular Formula | C26H35N5O2S |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | benzyl 3-[4-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]piperazin-1-yl]azetidine-1-carboxylate |
| SMILES | NC1CCN(Sc2cccc(N3CCN(C4CN(C(=O)OCc5ccccc5)C4)CC3)c2)CC1 |
| InChI | InChI=1S/C26H35N5O2S/c27-22-9-11-31(12-10-22)34-25-8-4-7-23(17-25)28-13-15-29(16-14-28)24-18-30(19-24)26(32)33-20-21-5-2-1-3-6-21/h1-8,17,22,24H,9-16,18-20,27H2 |
| InChIKey | OIBGFILBULHJMZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|