C17H25N3O2 — CID 118162425
benzyl 3-[(3R)-3,4-dimethylpiperazin-1-yl]azetidine-1-carboxylate (PubChem CID 118162425) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is benzyl 3-[(3R)-3,4-dimethylpiperazin-1-yl]azetidine-1-carboxylate.
| Compound Name | benzyl 3-[(3R)-3,4-dimethylpiperazin-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 118162425 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | benzyl 3-[(3R)-3,4-dimethylpiperazin-1-yl]azetidine-1-carboxylate |
| SMILES | C[C@@H]1CN(C2CN(C(=O)OCc3ccccc3)C2)CCN1C |
| InChI | InChI=1S/C17H25N3O2/c1-14-10-19(9-8-18(14)2)16-11-20(12-16)17(21)22-13-15-6-4-3-5-7-15/h3-7,14,16H,8-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | IACYHJKABQUPGS-CQSZACIVSA-N |
| XLogP | 1.64 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |