benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate

C16H21N3O3 — CID 156716445

IUPACbenzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate
SMILESCN1CCN(C2CN(C(=O)OCc3ccccc3)C2)C(=O)C1
InChIInChI=1S/C16H21N3O3/c1-17-7-8-19(15(20)11-17)14-9-18(10-14)16(21)22-12-13-5-3-2-4-6-13/h2-6,14H,7-12H2,1H3
InChIKeyKFLSBKJWGHDNIY-UHFFFAOYSA-N
MW303.36 g/mol
LogP0.78
Rot. Bonds3

About benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate

benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate (PubChem CID 156716445) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate
PubChem CID156716445
Molecular FormulaC16H21N3O3
Molecular Weight303.36 g/mol
Exact Mass303.16
IUPAC Namebenzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate
SMILESCN1CCN(C2CN(C(=O)OCc3ccccc3)C2)C(=O)C1
InChIInChI=1S/C16H21N3O3/c1-17-7-8-19(15(20)11-17)14-9-18(10-14)16(21)22-12-13-5-3-2-4-6-13/h2-6,14H,7-12H2,1H3
InChIKeyKFLSBKJWGHDNIY-UHFFFAOYSA-N
XLogP0.78
TPSA53.09 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.36
LogP ≤ 50.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate?
The IUPAC name of benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate (CID 156716445) is benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate.
What is the SMILES notation for benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate?
The canonical SMILES for benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate is CN1CCN(C2CN(C(=O)OCc3ccccc3)C2)C(=O)C1.
What is the InChIKey of benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate?
The InChIKey is KFLSBKJWGHDNIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O3/c1-17-7-8-19(15(20)11-17)14-9-18(10-14)16(21)22-12-13-5-3-2-4-6-13/h2-6,14H,7-12H2,1H3.
What are the key properties of benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate?
benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate has a molecular weight of 303.36 g/mol, XLogP of 0.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-(4-methyl-2-oxopiperazin-1-yl)azetidine-1-carboxylate is sourced from PubChem (CID 156716445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).