benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate

C18H27N3O2 — CID 70843461

IUPACbenzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate
SMILESNC1CCC(N2CCN(C(=O)OCc3ccccc3)CC2)CC1
InChIInChI=1S/C18H27N3O2/c19-16-6-8-17(9-7-16)20-10-12-21(13-11-20)18(22)23-14-15-4-2-1-3-5-15/h1-5,16-17H,6-14,19H2
InChIKeyXQOKDUFYCNVJPB-UHFFFAOYSA-N
MW317.43 g/mol
LogP2.21
Rot. Bonds3

About benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate

benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate (PubChem CID 70843461) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate.

Molecular Properties

Compound Namebenzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate
PubChem CID70843461
Molecular FormulaC18H27N3O2
Molecular Weight317.43 g/mol
Exact Mass317.21
IUPAC Namebenzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate
SMILESNC1CCC(N2CCN(C(=O)OCc3ccccc3)CC2)CC1
InChIInChI=1S/C18H27N3O2/c19-16-6-8-17(9-7-16)20-10-12-21(13-11-20)18(22)23-14-15-4-2-1-3-5-15/h1-5,16-17H,6-14,19H2
InChIKeyXQOKDUFYCNVJPB-UHFFFAOYSA-N
XLogP2.21
TPSA58.80 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.43
LogP ≤ 52.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate?
The IUPAC name of benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate (CID 70843461) is benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate.
What is the SMILES notation for benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate?
The canonical SMILES for benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate is NC1CCC(N2CCN(C(=O)OCc3ccccc3)CC2)CC1.
What is the InChIKey of benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate?
The InChIKey is XQOKDUFYCNVJPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O2/c19-16-6-8-17(9-7-16)20-10-12-21(13-11-20)18(22)23-14-15-4-2-1-3-5-15/h1-5,16-17H,6-14,19H2.
What are the key properties of benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate?
benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate has a molecular weight of 317.43 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(4-aminocyclohexyl)piperazine-1-carboxylate is sourced from PubChem (CID 70843461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).