C17H25N3O2 — CID 171820990
N-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-5-oxopentanamide (PubChem CID 171820990) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-5-oxopentanamide.
| Compound Name | N-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-5-oxopentanamide |
|---|---|
| PubChem CID | 171820990 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)c1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C17H25N3O2/c1-18-17(22)16(4-3-13-21)14-5-7-15(8-6-14)20-11-9-19(2)10-12-20/h5-8,13,16H,3-4,9-12H2,1-2H3,(H,18,22) |
| InChIKey | NICHSLJITWPQAS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|