C22H30F2N2O4 — CID 177028075
2-[2,6-difluoro-4-[(3S)-3-(hydroxymethyl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]phenyl]-N-methyl-5-oxopentanamide (PubChem CID 177028075) has the molecular formula C22H30F2N2O4 and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[(3S)-3-(hydroxymethyl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]phenyl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[2,6-difluoro-4-[(3S)-3-(hydroxymethyl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]phenyl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 177028075 |
| Molecular Formula | C22H30F2N2O4 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[2,6-difluoro-4-[(3S)-3-(hydroxymethyl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]phenyl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)c1c(F)cc(N2CCC3(CC[C@@H](CO)CO3)CC2)cc1F |
| InChI | InChI=1S/C22H30F2N2O4/c1-25-21(29)17(3-2-10-27)20-18(23)11-16(12-19(20)24)26-8-6-22(7-9-26)5-4-15(13-28)14-30-22/h10-12,15,17,28H,2-9,13-14H2,1H3,(H,25,29)/t15-,17?/m0/s1 |
| InChIKey | WEROLGVEGHPWPA-MYJWUSKBSA-N |
| XLogP | 2.53 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|