C25H36F2N4O2 — CID 177134552
2-[2,6-difluoro-4-[2-(4-methylpiperazin-1-yl)-7-azaspiro[3.5]nonan-7-yl]phenyl]-N-methyl-5-oxopentanamide (PubChem CID 177134552) has the molecular formula C25H36F2N4O2 and a molecular weight of 462.59 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[2-(4-methylpiperazin-1-yl)-7-azaspiro[3.5]nonan-7-yl]phenyl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[2,6-difluoro-4-[2-(4-methylpiperazin-1-yl)-7-azaspiro[3.5]nonan-7-yl]phenyl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 177134552 |
| Molecular Formula | C25H36F2N4O2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 2-[2,6-difluoro-4-[2-(4-methylpiperazin-1-yl)-7-azaspiro[3.5]nonan-7-yl]phenyl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)c1c(F)cc(N2CCC3(CC2)CC(N2CCN(C)CC2)C3)cc1F |
| InChI | InChI=1S/C25H36F2N4O2/c1-28-24(33)20(4-3-13-32)23-21(26)14-18(15-22(23)27)30-7-5-25(6-8-30)16-19(17-25)31-11-9-29(2)10-12-31/h13-15,19-20H,3-12,16-17H2,1-2H3,(H,28,33) |
| InChIKey | GDDAZVWSZIYGEY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|