C31H40N6O4 — CID 166143354
N-acetyl-4-[4-[2-(4-aminophenyl)-2,6-diazaspiro[3.3]heptan-6-yl]piperidin-1-yl]-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide (PubChem CID 166143354) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is N-acetyl-4-[4-[2-(4-aminophenyl)-2,6-diazaspiro[3.3]heptan-6-yl]piperidin-1-yl]-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide.
| Compound Name | N-acetyl-4-[4-[2-(4-aminophenyl)-2,6-diazaspiro[3.3]heptan-6-yl]piperidin-1-yl]-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 166143354 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | N-acetyl-4-[4-[2-(4-aminophenyl)-2,6-diazaspiro[3.3]heptan-6-yl]piperidin-1-yl]-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide |
| SMILES | CNC(=O)C(CCC=O)N(C(C)=O)C(=O)c1ccc(N2CCC(N3CC4(CN(c5ccc(N)cc5)C4)C3)CC2)cc1 |
| InChI | InChI=1S/C31H40N6O4/c1-22(39)37(28(4-3-17-38)29(40)33-2)30(41)23-5-9-25(10-6-23)34-15-13-27(14-16-34)36-20-31(21-36)18-35(19-31)26-11-7-24(32)8-12-26/h5-12,17,27-28H,3-4,13-16,18-21,32H2,1-2H3,(H,33,40) |
| InChIKey | LEKSMHKXEJGACN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|