C39H45N7O3 — CID 177338792
2-[4-[4-[4-[4-[(2E)-2-[2-(2-hydroxyphenyl)-2-iminoethylidene]-3-iminopyrrol-1-yl]phenyl]piperazin-1-yl]piperidin-1-yl]phenyl]-N-methyl-5-oxopentanamide (PubChem CID 177338792) has the molecular formula C39H45N7O3 and a molecular weight of 659.84 g/mol. Its IUPAC name is 2-[4-[4-[4-[4-[(2E)-2-[2-(2-hydroxyphenyl)-2-iminoethylidene]-3-iminopyrrol-1-yl]phenyl]piperazin-1-yl]piperidin-1-yl]phenyl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[4-[4-[4-[4-[(2E)-2-[2-(2-hydroxyphenyl)-2-iminoethylidene]-3-iminopyrrol-1-yl]phenyl]piperazin-1-yl]piperidin-1-yl]phenyl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 177338792 |
| Molecular Formula | C39H45N7O3 |
| Molecular Weight | 659.84 g/mol |
| Exact Mass | 659.36 |
| IUPAC Name | 2-[4-[4-[4-[4-[(2E)-2-[2-(2-hydroxyphenyl)-2-iminoethylidene]-3-iminopyrrol-1-yl]phenyl]piperazin-1-yl]piperidin-1-yl]phenyl]-N-methyl-5-oxopentanamide |
| SMILES | [H]/N=C(/C=C1C(=N\[H])\C=CN\1c1ccc(N2CCN(C3CCN(c4ccc(C(CCC=O)C(=O)NC)cc4)CC3)CC2)cc1)c1ccccc1O |
| InChI | InChI=1S/C39H45N7O3/c1-42-39(49)33(6-4-26-47)28-8-10-29(11-9-28)43-19-16-31(17-20-43)45-24-22-44(23-25-45)30-12-14-32(15-13-30)46-21-18-35(40)37(46)27-36(41)34-5-2-3-7-38(34)48/h2-3,5,7-15,18,21,26-27,31,33,40-41,48H,4,6,16-17,19-20,22-25H2,1H3,(H,42,49)/b37-27+,40-35+,41-36- |
| InChIKey | HMPAPIYJDNVQBC-UIOTUJTDSA-N |
| XLogP | 5.30 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.84 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|