C29H46N4O4 — CID 170737740
tert-butyl N-[4-[2-[4-[4-[1-(methylamino)-1,5-dioxopentan-2-yl]phenyl]piperazin-1-yl]ethyl]cyclohexyl]carbamate (PubChem CID 170737740) has the molecular formula C29H46N4O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[4-[4-[1-(methylamino)-1,5-dioxopentan-2-yl]phenyl]piperazin-1-yl]ethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[4-[4-[1-(methylamino)-1,5-dioxopentan-2-yl]phenyl]piperazin-1-yl]ethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 170737740 |
| Molecular Formula | C29H46N4O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | tert-butyl N-[4-[2-[4-[4-[1-(methylamino)-1,5-dioxopentan-2-yl]phenyl]piperazin-1-yl]ethyl]cyclohexyl]carbamate |
| SMILES | CNC(=O)C(CCC=O)c1ccc(N2CCN(CCC3CCC(NC(=O)OC(C)(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H46N4O4/c1-29(2,3)37-28(36)31-24-11-7-22(8-12-24)15-16-32-17-19-33(20-18-32)25-13-9-23(10-14-25)26(6-5-21-34)27(35)30-4/h9-10,13-14,21-22,24,26H,5-8,11-12,15-20H2,1-4H3,(H,30,35)(H,31,36) |
| InChIKey | LAMDFQWPVJGPMX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|