C36H42N6O4 — CID 177002991
2-[4-[3-[4-[4-[(Z)-1-amino-4-(2-hydroxyphenyl)-1,4-diiminobut-2-en-2-yl]phenyl]piperidin-1-yl]azetidin-1-yl]phenoxy]-N-methyl-5-oxopentanamide (PubChem CID 177002991) has the molecular formula C36H42N6O4 and a molecular weight of 622.77 g/mol. Its IUPAC name is 2-[4-[3-[4-[4-[(Z)-1-amino-4-(2-hydroxyphenyl)-1,4-diiminobut-2-en-2-yl]phenyl]piperidin-1-yl]azetidin-1-yl]phenoxy]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[4-[3-[4-[4-[(Z)-1-amino-4-(2-hydroxyphenyl)-1,4-diiminobut-2-en-2-yl]phenyl]piperidin-1-yl]azetidin-1-yl]phenoxy]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 177002991 |
| Molecular Formula | C36H42N6O4 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 2-[4-[3-[4-[4-[(Z)-1-amino-4-(2-hydroxyphenyl)-1,4-diiminobut-2-en-2-yl]phenyl]piperidin-1-yl]azetidin-1-yl]phenoxy]-N-methyl-5-oxopentanamide |
| SMILES | [H]/N=C(N)/C(=C\C(=N\[H])c1ccccc1O)c1ccc(C2CCN(C3CN(c4ccc(OC(CCC=O)C(=O)NC)cc4)C3)CC2)cc1 |
| InChI | InChI=1S/C36H42N6O4/c1-40-36(45)34(7-4-20-43)46-29-14-12-27(13-15-29)42-22-28(23-42)41-18-16-25(17-19-41)24-8-10-26(11-9-24)31(35(38)39)21-32(37)30-5-2-3-6-33(30)44/h2-3,5-6,8-15,20-21,25,28,34,37,44H,4,7,16-19,22-23H2,1H3,(H3,38,39)(H,40,45)/b31-21-,37-32- |
| InChIKey | VYRVTEZMWURYEO-MSWVJDCZSA-N |
| XLogP | 4.32 |
| TPSA | 155.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|