C36H41N5O3 — CID 177002913
(Z)-4-(2-hydroxyphenyl)-4-imino-2-[4-[4-[4-[4-(2-oxooxolan-3-yl)phenyl]piperidin-1-yl]piperidin-1-yl]phenyl]but-2-enimidamide (PubChem CID 177002913) has the molecular formula C36H41N5O3 and a molecular weight of 591.76 g/mol. Its IUPAC name is (Z)-4-(2-hydroxyphenyl)-4-imino-2-[4-[4-[4-[4-(2-oxooxolan-3-yl)phenyl]piperidin-1-yl]piperidin-1-yl]phenyl]but-2-enimidamide.
| Compound Name | (Z)-4-(2-hydroxyphenyl)-4-imino-2-[4-[4-[4-[4-(2-oxooxolan-3-yl)phenyl]piperidin-1-yl]piperidin-1-yl]phenyl]but-2-enimidamide |
|---|---|
| PubChem CID | 177002913 |
| Molecular Formula | C36H41N5O3 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.32 |
| IUPAC Name | (Z)-4-(2-hydroxyphenyl)-4-imino-2-[4-[4-[4-[4-(2-oxooxolan-3-yl)phenyl]piperidin-1-yl]piperidin-1-yl]phenyl]but-2-enimidamide |
| SMILES | [H]/N=C(N)/C(=C\C(=N\[H])c1ccccc1O)c1ccc(N2CCC(N3CCC(c4ccc(C5CCOC5=O)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C36H41N5O3/c37-33(31-3-1-2-4-34(31)42)23-32(35(38)39)27-9-11-28(12-10-27)41-20-15-29(16-21-41)40-18-13-25(14-19-40)24-5-7-26(8-6-24)30-17-22-44-36(30)43/h1-12,23,25,29-30,37,42H,13-22H2,(H3,38,39)/b32-23-,37-33- |
| InChIKey | JCSBTQHKFIXPBY-MMRSJMICSA-N |
| XLogP | 5.66 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|