C21H23N5O2 — CID 155740776
(E)-2-[4-(4-formylphenyl)piperazin-1-yl]-4-(2-hydroxyphenyl)-4-iminobut-2-enimidamide (PubChem CID 155740776) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is (E)-2-[4-(4-formylphenyl)piperazin-1-yl]-4-(2-hydroxyphenyl)-4-iminobut-2-enimidamide.
| Compound Name | (E)-2-[4-(4-formylphenyl)piperazin-1-yl]-4-(2-hydroxyphenyl)-4-iminobut-2-enimidamide |
|---|---|
| PubChem CID | 155740776 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (E)-2-[4-(4-formylphenyl)piperazin-1-yl]-4-(2-hydroxyphenyl)-4-iminobut-2-enimidamide |
| SMILES | [H]/N=C(N)/C(=C\C(=N\[H])c1ccccc1O)N1CCN(c2ccc(C=O)cc2)CC1 |
| InChI | InChI=1S/C21H23N5O2/c22-18(17-3-1-2-4-20(17)28)13-19(21(23)24)26-11-9-25(10-12-26)16-7-5-15(14-27)6-8-16/h1-8,13-14,22,28H,9-12H2,(H3,23,24)/b19-13+,22-18- |
| InChIKey | URKLSQDZJQVGBG-XSRHVAFNSA-N |
| XLogP | 2.21 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|