C24H38N8O6S — CID 71755493
bis(4-(4-methoxyphenyl)piperazine-1-carboximidamide);sulfuric acid (PubChem CID 71755493) has the molecular formula C24H38N8O6S and a molecular weight of 566.69 g/mol. Its IUPAC name is bis(4-(4-methoxyphenyl)piperazine-1-carboximidamide);sulfuric acid.
| Compound Name | bis(4-(4-methoxyphenyl)piperazine-1-carboximidamide);sulfuric acid |
|---|---|
| PubChem CID | 71755493 |
| Molecular Formula | C24H38N8O6S |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | bis(4-(4-methoxyphenyl)piperazine-1-carboximidamide);sulfuric acid |
| SMILES | O=S(=O)(O)O.[H]/N=C(\N)N1CCN(c2ccc(OC)cc2)CC1.[H]/N=C(\N)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/2C12H18N4O.H2O4S/c2*1-17-11-4-2-10(3-5-11)15-6-8-16(9-7-15)12(13)14;1-5(2,3)4/h2*2-5H,6-9H2,1H3,(H3,13,14);(H2,1,2,3,4) |
| InChIKey | KHIFXNDSBFWOIR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|