C26H42N8O6S — CID 3043161
bis(4-[(3-methoxyphenyl)methyl]piperazine-1-carboximidamide);sulfuric acid (PubChem CID 3043161) has the molecular formula C26H42N8O6S and a molecular weight of 594.74 g/mol. Its IUPAC name is bis(4-[(3-methoxyphenyl)methyl]piperazine-1-carboximidamide);sulfuric acid.
| Compound Name | bis(4-[(3-methoxyphenyl)methyl]piperazine-1-carboximidamide);sulfuric acid |
|---|---|
| PubChem CID | 3043161 |
| Molecular Formula | C26H42N8O6S |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | bis(4-[(3-methoxyphenyl)methyl]piperazine-1-carboximidamide);sulfuric acid |
| SMILES | O=S(=O)(O)O.[H]/N=C(\N)N1CCN(Cc2cccc(OC)c2)CC1.[H]/N=C(\N)N1CCN(Cc2cccc(OC)c2)CC1 |
| InChI | InChI=1S/2C13H20N4O.H2O4S/c2*1-18-12-4-2-3-11(9-12)10-16-5-7-17(8-6-16)13(14)15;1-5(2,3)4/h2*2-4,9H,5-8,10H2,1H3,(H3,14,15);(H2,1,2,3,4) |
| InChIKey | RXZPMGMKDNMMQI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|