C25H32N8O — CID 170628376
(E)-4-(2-hydroxyphenyl)-4-imino-2-[4-[2-[3-(propylamino)prop-1-ynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]but-2-enimidamide (PubChem CID 170628376) has the molecular formula C25H32N8O and a molecular weight of 460.59 g/mol. Its IUPAC name is (E)-4-(2-hydroxyphenyl)-4-imino-2-[4-[2-[3-(propylamino)prop-1-ynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]but-2-enimidamide.
| Compound Name | (E)-4-(2-hydroxyphenyl)-4-imino-2-[4-[2-[3-(propylamino)prop-1-ynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]but-2-enimidamide |
|---|---|
| PubChem CID | 170628376 |
| Molecular Formula | C25H32N8O |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | (E)-4-(2-hydroxyphenyl)-4-imino-2-[4-[2-[3-(propylamino)prop-1-ynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]but-2-enimidamide |
| SMILES | [H]/N=C(N)/C(=C\C(=N\[H])c1ccccc1O)N1CCCN(c2ccnc(C#CCNCCC)n2)CC1 |
| InChI | InChI=1S/C25H32N8O/c1-2-11-29-12-5-9-23-30-13-10-24(31-23)33-15-6-14-32(16-17-33)21(25(27)28)18-20(26)19-7-3-4-8-22(19)34/h3-4,7-8,10,13,18,26,29,34H,2,6,11-12,14-17H2,1H3,(H3,27,28)/b21-18+,26-20- |
| InChIKey | INZRQJCNGAYRMR-DLFMKZCDSA-N |
| XLogP | 1.93 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|