C26H30N8O — CID 170628510
2-[6-amino-5-[9-[2-(3-aminoprop-1-ynyl)pyrimidin-4-yl]-2,9-diazaspiro[5.5]undecan-2-yl]pyridazin-3-yl]phenol (PubChem CID 170628510) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is 2-[6-amino-5-[9-[2-(3-aminoprop-1-ynyl)pyrimidin-4-yl]-2,9-diazaspiro[5.5]undecan-2-yl]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[9-[2-(3-aminoprop-1-ynyl)pyrimidin-4-yl]-2,9-diazaspiro[5.5]undecan-2-yl]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 170628510 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[6-amino-5-[9-[2-(3-aminoprop-1-ynyl)pyrimidin-4-yl]-2,9-diazaspiro[5.5]undecan-2-yl]pyridazin-3-yl]phenol |
| SMILES | NCC#Cc1nccc(N2CCC3(CCCN(c4cc(-c5ccccc5O)nnc4N)C3)CC2)n1 |
| InChI | InChI=1S/C26H30N8O/c27-12-3-7-23-29-13-8-24(30-23)33-15-10-26(11-16-33)9-4-14-34(18-26)21-17-20(31-32-25(21)28)19-5-1-2-6-22(19)35/h1-2,5-6,8,13,17,35H,4,9-12,14-16,18,27H2,(H2,28,32) |
| InChIKey | CSAFCJBBUBLSNN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|