C26H32N8O — CID 170628278
2-[6-amino-5-[4-[2-[3-(butan-2-ylamino)prop-1-ynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol (PubChem CID 170628278) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is 2-[6-amino-5-[4-[2-[3-(butan-2-ylamino)prop-1-ynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[4-[2-[3-(butan-2-ylamino)prop-1-ynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 170628278 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 2-[6-amino-5-[4-[2-[3-(butan-2-ylamino)prop-1-ynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol |
| SMILES | CCC(C)NCC#Cc1nccc(N2CCCN(c3cc(-c4ccccc4O)nnc3N)CC2)n1 |
| InChI | InChI=1S/C26H32N8O/c1-3-19(2)28-12-6-10-24-29-13-11-25(30-24)34-15-7-14-33(16-17-34)22-18-21(31-32-26(22)27)20-8-4-5-9-23(20)35/h4-5,8-9,11,13,18-19,28,35H,3,7,12,14-17H2,1-2H3,(H2,27,32) |
| InChIKey | FNALYWQSIHZVBJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|