C25H25N9O — CID 170628271
2-[6-amino-5-[4-[2-[2-(1-methylimidazol-2-yl)ethynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol (PubChem CID 170628271) has the molecular formula C25H25N9O and a molecular weight of 467.54 g/mol. Its IUPAC name is 2-[6-amino-5-[4-[2-[2-(1-methylimidazol-2-yl)ethynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[4-[2-[2-(1-methylimidazol-2-yl)ethynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 170628271 |
| Molecular Formula | C25H25N9O |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-[6-amino-5-[4-[2-[2-(1-methylimidazol-2-yl)ethynyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol |
| SMILES | Cn1ccnc1C#Cc1nccc(N2CCCN(c3cc(-c4ccccc4O)nnc3N)CC2)n1 |
| InChI | InChI=1S/C25H25N9O/c1-32-14-11-28-23(32)8-7-22-27-10-9-24(29-22)34-13-4-12-33(15-16-34)20-17-19(30-31-25(20)26)18-5-2-3-6-21(18)35/h2-3,5-6,9-11,14,17,35H,4,12-13,15-16H2,1H3,(H2,26,31) |
| InChIKey | AZPLDOXXFVECDS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|