C26H37N5O — CID 171638911
ethane;(E)-4-(2-hydroxyphenyl)-4-imino-2-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]but-2-enimidamide (PubChem CID 171638911) has the molecular formula C26H37N5O and a molecular weight of 435.62 g/mol. Its IUPAC name is ethane;(E)-4-(2-hydroxyphenyl)-4-imino-2-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]but-2-enimidamide.
| Compound Name | ethane;(E)-4-(2-hydroxyphenyl)-4-imino-2-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]but-2-enimidamide |
|---|---|
| PubChem CID | 171638911 |
| Molecular Formula | C26H37N5O |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | ethane;(E)-4-(2-hydroxyphenyl)-4-imino-2-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]but-2-enimidamide |
| SMILES | CC.[H]/N=C(N)/C(=C\C(=N\[H])c1ccccc1O)N1CCN(Cc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C24H31N5O.C2H6/c1-17(2)19-9-7-18(8-10-19)16-28-11-13-29(14-12-28)22(24(26)27)15-21(25)20-5-3-4-6-23(20)30;1-2/h3-10,15,17,25,30H,11-14,16H2,1-2H3,(H3,26,27);1-2H3/b22-15+,25-21-; |
| InChIKey | YCGDVVOCBORRMC-KDIUIIIASA-N |
| XLogP | 4.55 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|