C22H24N4O2 — CID 177003155
(Z)-4-(2-hydroxyphenyl)-4-imino-N'-methyl-2-[4-(4-oxopiperidin-1-yl)phenyl]but-2-enimidamide (PubChem CID 177003155) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (Z)-4-(2-hydroxyphenyl)-4-imino-N'-methyl-2-[4-(4-oxopiperidin-1-yl)phenyl]but-2-enimidamide.
| Compound Name | (Z)-4-(2-hydroxyphenyl)-4-imino-N'-methyl-2-[4-(4-oxopiperidin-1-yl)phenyl]but-2-enimidamide |
|---|---|
| PubChem CID | 177003155 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (Z)-4-(2-hydroxyphenyl)-4-imino-N'-methyl-2-[4-(4-oxopiperidin-1-yl)phenyl]but-2-enimidamide |
| SMILES | [H]/N=C(/C=C(C(\N)=N\C)/c1ccc(N2CCC(=O)CC2)cc1)c1ccccc1O |
| InChI | InChI=1S/C22H24N4O2/c1-25-22(24)19(14-20(23)18-4-2-3-5-21(18)28)15-6-8-16(9-7-15)26-12-10-17(27)11-13-26/h2-9,14,23,28H,10-13H2,1H3,(H2,24,25)/b19-14-,23-20- |
| InChIKey | AJJDKRNXJNBAAH-IVCRMHHOSA-N |
| XLogP | 3.00 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|