C24H32N4O3 — CID 177003107
2-[(1Z)-1,4,4-triamino-3-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]buta-1,3-dienyl]phenol (PubChem CID 177003107) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]buta-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 177003107 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]buta-1,3-dienyl]phenol |
| SMILES | COC(OC)C1CCN(c2ccc(C(/C=C(\N)c3ccccc3O)=C(N)N)cc2)CC1 |
| InChI | InChI=1S/C24H32N4O3/c1-30-24(31-2)17-11-13-28(14-12-17)18-9-7-16(8-10-18)20(23(26)27)15-21(25)19-5-3-4-6-22(19)29/h3-10,15,17,24,29H,11-14,25-27H2,1-2H3/b21-15- |
| InChIKey | JJCWIGUIDHCHHG-QNGOZBTKSA-N |
| XLogP | 2.81 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|