C37H46N6O2 — CID 177003114
2-[4-[4-[[4-[4-[(Z)-1-amino-1,4-diimino-4-phenylbut-2-en-2-yl]phenyl]piperidin-1-yl]methyl]piperidin-1-yl]phenoxy]butanamide (PubChem CID 177003114) has the molecular formula C37H46N6O2 and a molecular weight of 606.82 g/mol. Its IUPAC name is 2-[4-[4-[[4-[4-[(Z)-1-amino-1,4-diimino-4-phenylbut-2-en-2-yl]phenyl]piperidin-1-yl]methyl]piperidin-1-yl]phenoxy]butanamide.
| Compound Name | 2-[4-[4-[[4-[4-[(Z)-1-amino-1,4-diimino-4-phenylbut-2-en-2-yl]phenyl]piperidin-1-yl]methyl]piperidin-1-yl]phenoxy]butanamide |
|---|---|
| PubChem CID | 177003114 |
| Molecular Formula | C37H46N6O2 |
| Molecular Weight | 606.82 g/mol |
| Exact Mass | 606.37 |
| IUPAC Name | 2-[4-[4-[[4-[4-[(Z)-1-amino-1,4-diimino-4-phenylbut-2-en-2-yl]phenyl]piperidin-1-yl]methyl]piperidin-1-yl]phenoxy]butanamide |
| SMILES | [H]/N=C(N)/C(=C\C(=N\[H])c1ccccc1)c1ccc(C2CCN(CC3CCN(c4ccc(OC(CC)C(N)=O)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C37H46N6O2/c1-2-35(37(41)44)45-32-14-12-31(13-15-32)43-22-16-26(17-23-43)25-42-20-18-28(19-21-42)27-8-10-29(11-9-27)33(36(39)40)24-34(38)30-6-4-3-5-7-30/h3-15,24,26,28,35,38H,2,16-23,25H2,1H3,(H3,39,40)(H2,41,44)/b33-24-,38-34- |
| InChIKey | VXHYRIKVEOQWCO-UFSHYDAJSA-N |
| XLogP | 5.81 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.82 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|