C25H33NO2 — CID 153105171
2-[4-[1-(4-ethoxyphenyl)piperidin-4-yl]phenyl]hexan-3-one (PubChem CID 153105171) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 2-[4-[1-(4-ethoxyphenyl)piperidin-4-yl]phenyl]hexan-3-one.
| Compound Name | 2-[4-[1-(4-ethoxyphenyl)piperidin-4-yl]phenyl]hexan-3-one |
|---|---|
| PubChem CID | 153105171 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-[4-[1-(4-ethoxyphenyl)piperidin-4-yl]phenyl]hexan-3-one |
| SMILES | CCCC(=O)C(C)c1ccc(C2CCN(c3ccc(OCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H33NO2/c1-4-6-25(27)19(3)20-7-9-21(10-8-20)22-15-17-26(18-16-22)23-11-13-24(14-12-23)28-5-2/h7-14,19,22H,4-6,15-18H2,1-3H3 |
| InChIKey | VRVQTPCPDJWCMM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|