C26H35N3O2 — CID 71616117
3-[(1S)-1-[4-[4-[4-(cyclopropylmethoxy)phenyl]piperidin-1-yl]phenyl]ethyl]-1,1-dimethylurea (PubChem CID 71616117) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-[(1S)-1-[4-[4-[4-(cyclopropylmethoxy)phenyl]piperidin-1-yl]phenyl]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[(1S)-1-[4-[4-[4-(cyclopropylmethoxy)phenyl]piperidin-1-yl]phenyl]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 71616117 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 3-[(1S)-1-[4-[4-[4-(cyclopropylmethoxy)phenyl]piperidin-1-yl]phenyl]ethyl]-1,1-dimethylurea |
| SMILES | C[C@H](NC(=O)N(C)C)c1ccc(N2CCC(c3ccc(OCC4CC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H35N3O2/c1-19(27-26(30)28(2)3)21-6-10-24(11-7-21)29-16-14-23(15-17-29)22-8-12-25(13-9-22)31-18-20-4-5-20/h6-13,19-20,23H,4-5,14-18H2,1-3H3,(H,27,30)/t19-/m0/s1 |
| InChIKey | XLHIYOBEHSEILV-IBGZPJMESA-N |
| XLogP | 5.19 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|